About 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine
6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine (PubChem CID 178100135) has the molecular formula C20H32N4O
and a molecular weight of 344.50 g/mol. Its IUPAC name is 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine.
Molecular Properties
| Compound Name | 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine |
| PubChem CID | 178100135 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine |
| SMILES | CCCCNC1=C(N(C)Cc2ccccc2)NC(OCCCC)N=C1 |
| InChI | InChI=1S/C20H32N4O/c1-4-6-13-21-18-15-22-20(25-14-7-5-2)23-19(18)24(3)16-17-11-9-8-10-12-17/h8-12,15,20-21,23H,4-7,13-14,16H2,1-3H3 |
| InChIKey | JAACVSXRSAIEPN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine?
The IUPAC name of 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine (CID 178100135) is 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine.
What is the SMILES notation for 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine?
The canonical SMILES for 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine is CCCCNC1=C(N(C)Cc2ccccc2)NC(OCCCC)N=C1.
What is the InChIKey of 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine?
The InChIKey is JAACVSXRSAIEPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N4O/c1-4-6-13-21-18-15-22-20(25-14-7-5-2)23-19(18)24(3)16-17-11-9-8-10-12-17/h8-12,15,20-21,23H,4-7,13-14,16H2,1-3H3.
What are the key properties of 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine?
6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine has a molecular weight of 344.50 g/mol, XLogP of 3.45, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N-benzyl-2-butoxy-5-N-butyl-6-N-methyl-1,2-dihydropyrimidine-5,6-diamine is sourced from PubChem (CID 178100135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).