C18H25N5O3 — CID 178100274
ethyl 2-(butylamino)-4-[(6-methoxy-3-pyridinyl)methylamino]pyrimidine-5-carboxylate (PubChem CID 178100274) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is ethyl 2-(butylamino)-4-[(6-methoxy-3-pyridinyl)methylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(butylamino)-4-[(6-methoxy-3-pyridinyl)methylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 178100274 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | ethyl 2-(butylamino)-4-[(6-methoxy-3-pyridinyl)methylamino]pyrimidine-5-carboxylate |
| SMILES | CCCCNc1ncc(C(=O)OCC)c(NCc2ccc(OC)nc2)n1 |
| InChI | InChI=1S/C18H25N5O3/c1-4-6-9-19-18-22-12-14(17(24)26-5-2)16(23-18)21-11-13-7-8-15(25-3)20-10-13/h7-8,10,12H,4-6,9,11H2,1-3H3,(H2,19,21,22,23) |
| InChIKey | BPBZPSURQJCKMX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|