C21H36N4O2 — CID 178100296
6-N-benzyl-2-butoxy-6-N-methyl-5-N-prop-2-enyl-1,2-dihydropyrimidine-5,6-diamine;ethane;hydrate (PubChem CID 178100296) has the molecular formula C21H36N4O2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 6-N-benzyl-2-butoxy-6-N-methyl-5-N-prop-2-enyl-1,2-dihydropyrimidine-5,6-diamine;ethane;hydrate.
| Compound Name | 6-N-benzyl-2-butoxy-6-N-methyl-5-N-prop-2-enyl-1,2-dihydropyrimidine-5,6-diamine;ethane;hydrate |
|---|---|
| PubChem CID | 178100296 |
| Molecular Formula | C21H36N4O2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | 6-N-benzyl-2-butoxy-6-N-methyl-5-N-prop-2-enyl-1,2-dihydropyrimidine-5,6-diamine;ethane;hydrate |
| SMILES | C=CCNC1=C(N(C)Cc2ccccc2)NC(OCCCC)N=C1.CC.O |
| InChI | InChI=1S/C19H28N4O.C2H6.H2O/c1-4-6-13-24-19-21-14-17(20-12-5-2)18(22-19)23(3)15-16-10-8-7-9-11-16;1-2;/h5,7-11,14,19-20,22H,2,4,6,12-13,15H2,1,3H3;1-2H3;1H2 |
| InChIKey | DMXGQNSVVGGMQB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|