C21H17F2N5O5 — CID 178100748
1-[[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178100748) has the molecular formula C21H17F2N5O5 and a molecular weight of 457.39 g/mol. Its IUPAC name is 1-[[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 1-[[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178100748 |
| Molecular Formula | C21H17F2N5O5 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 1-[[3-(2,6-difluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4c(F)cccc4F)no2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C21H17F2N5O5/c22-11-4-1-5-12(23)16(11)18-25-15(33-26-18)9-27-8-2-3-10-17(27)21(32)28(20(10)31)13-6-7-14(29)24-19(13)30/h1,4-5,13H,2-3,6-9H2,(H,24,29,30) |
| InChIKey | NYZLERXITFPGPI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|