C23H19N5O5S — CID 178100862
1-[[3-(1-benzothiophen-6-yl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178100862) has the molecular formula C23H19N5O5S and a molecular weight of 477.50 g/mol. Its IUPAC name is 1-[[3-(1-benzothiophen-6-yl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 1-[[3-(1-benzothiophen-6-yl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178100862 |
| Molecular Formula | C23H19N5O5S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 1-[[3-(1-benzothiophen-6-yl)-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4ccc5ccsc5c4)no2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C23H19N5O5S/c29-17-6-5-15(21(30)24-17)28-22(31)14-2-1-8-27(19(14)23(28)32)11-18-25-20(26-33-18)13-4-3-12-7-9-34-16(12)10-13/h3-4,7,9-10,15H,1-2,5-6,8,11H2,(H,24,29,30) |
| InChIKey | CMCOCGQUUACJAV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|