C21H18FN5O5S — CID 178100874
[3-[5,7-dioxo-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-2,6-dioxopiperidin-1-yl] thiohypofluorite (PubChem CID 178100874) has the molecular formula C21H18FN5O5S and a molecular weight of 471.47 g/mol. Its IUPAC name is [3-[5,7-dioxo-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-2,6-dioxopiperidin-1-yl] thiohypofluorite.
| Compound Name | [3-[5,7-dioxo-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-2,6-dioxopiperidin-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 178100874 |
| Molecular Formula | C21H18FN5O5S |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | [3-[5,7-dioxo-1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-2,6-dioxopiperidin-1-yl] thiohypofluorite |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4ccccc4)no2)CCC3)C(=O)N1SF |
| InChI | InChI=1S/C21H18FN5O5S/c22-33-27-16(28)9-8-14(20(27)30)26-19(29)13-7-4-10-25(17(13)21(26)31)11-15-23-18(24-32-15)12-5-2-1-3-6-12/h1-3,5-6,14H,4,7-11H2 |
| InChIKey | LLDLDEGBHLOEAM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|