C27H22FN5O5 — CID 178100927
6-(2,6-dioxopiperidin-3-yl)-1-[[3-(2-fluoro-3-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178100927) has the molecular formula C27H22FN5O5 and a molecular weight of 515.50 g/mol. Its IUPAC name is 6-(2,6-dioxopiperidin-3-yl)-1-[[3-(2-fluoro-3-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(2,6-dioxopiperidin-3-yl)-1-[[3-(2-fluoro-3-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178100927 |
| Molecular Formula | C27H22FN5O5 |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 6-(2,6-dioxopiperidin-3-yl)-1-[[3-(2-fluoro-3-phenylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4cccc(-c5ccccc5)c4F)no2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C27H22FN5O5/c28-22-16(15-6-2-1-3-7-15)8-4-9-17(22)24-30-21(38-31-24)14-32-13-5-10-18-23(32)27(37)33(26(18)36)19-11-12-20(34)29-25(19)35/h1-4,6-9,19H,5,10-14H2,(H,29,34,35) |
| InChIKey | ITDVLXMBDKCZEG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|