C21H19N5O4S — CID 178100951
6-(2,6-dioxopiperidin-3-yl)-1-[(3-phenyl-1,2,4-thiadiazol-5-yl)methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178100951) has the molecular formula C21H19N5O4S and a molecular weight of 437.48 g/mol. Its IUPAC name is 6-(2,6-dioxopiperidin-3-yl)-1-[(3-phenyl-1,2,4-thiadiazol-5-yl)methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(2,6-dioxopiperidin-3-yl)-1-[(3-phenyl-1,2,4-thiadiazol-5-yl)methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178100951 |
| Molecular Formula | C21H19N5O4S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 6-(2,6-dioxopiperidin-3-yl)-1-[(3-phenyl-1,2,4-thiadiazol-5-yl)methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4ccccc4)ns2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C21H19N5O4S/c27-15-9-8-14(19(28)22-15)26-20(29)13-7-4-10-25(17(13)21(26)30)11-16-23-18(24-31-16)12-5-2-1-3-6-12/h1-3,5-6,14H,4,7-11H2,(H,22,27,28) |
| InChIKey | AGOYKKPRWCIWEL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|