C25H21N5O4S2 — CID 178100953
6-(2,6-dioxopiperidin-3-yl)-1-[[3-(3-thiophen-3-ylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178100953) has the molecular formula C25H21N5O4S2 and a molecular weight of 519.61 g/mol. Its IUPAC name is 6-(2,6-dioxopiperidin-3-yl)-1-[[3-(3-thiophen-3-ylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-(2,6-dioxopiperidin-3-yl)-1-[[3-(3-thiophen-3-ylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178100953 |
| Molecular Formula | C25H21N5O4S2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 6-(2,6-dioxopiperidin-3-yl)-1-[[3-(3-thiophen-3-ylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4cccc(-c5ccsc5)c4)ns2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C25H21N5O4S2/c31-19-7-6-18(23(32)26-19)30-24(33)17-5-2-9-29(21(17)25(30)34)12-20-27-22(28-36-20)15-4-1-3-14(11-15)16-8-10-35-13-16/h1,3-4,8,10-11,13,18H,2,5-7,9,12H2,(H,26,31,32) |
| InChIKey | KSVYTNDTIYTWIH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|