C13H19NO — CID 178101005
ethane;2-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-1,3-oxazole (PubChem CID 178101005) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;2-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-1,3-oxazole.
| Compound Name | ethane;2-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-1,3-oxazole |
|---|---|
| PubChem CID | 178101005 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | ethane;2-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-1,3-oxazole |
| SMILES | C=C(C)/C=C(/C=C\C)c1ncco1.CC |
| InChI | InChI=1S/C11H13NO.C2H6/c1-4-5-10(8-9(2)3)11-12-6-7-13-11;1-2/h4-8H,2H2,1,3H3;1-2H3/b5-4-,10-8+; |
| InChIKey | URNSEOVANQKVPJ-VKDWVPERSA-N |
| XLogP | 4.24 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|