C10H19NO — CID 178101595
dideuterio-[(3S,6R)-3,6-dimethyl-4-methylidene-1-(trideuteriomethyl)piperidin-3-yl]methanol (PubChem CID 178101595) has the molecular formula C10H19NO and a molecular weight of 174.30 g/mol. Its IUPAC name is dideuterio-[(3S,6R)-3,6-dimethyl-4-methylidene-1-(trideuteriomethyl)piperidin-3-yl]methanol.
| Compound Name | dideuterio-[(3S,6R)-3,6-dimethyl-4-methylidene-1-(trideuteriomethyl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 178101595 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 174.30 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | dideuterio-[(3S,6R)-3,6-dimethyl-4-methylidene-1-(trideuteriomethyl)piperidin-3-yl]methanol |
| SMILES | [2H]C([2H])([2H])N1C[C@@](C)(C([2H])([2H])O)C(=C)C[C@H]1C |
| InChI | InChI=1S/C10H19NO/c1-8-5-9(2)11(4)6-10(8,3)7-12/h9,12H,1,5-7H2,2-4H3/t9-,10+/m1/s1/i4D3,7D2 |
| InChIKey | DXONEJGPXLXFAT-LBWCNXHSSA-N |
| XLogP | 1.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|