About (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine
(2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine (PubChem CID 178101614) has the molecular formula C9H17F2N
and a molecular weight of 177.24 g/mol. Its IUPAC name is (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine |
| PubChem CID | 178101614 |
| Molecular Formula | C9H17F2N |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine |
| SMILES | CC[C@]1(C)C[C@H](C(F)F)CN1C |
| InChI | InChI=1S/C9H17F2N/c1-4-9(2)5-7(8(10)11)6-12(9)3/h7-8H,4-6H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | HEIMSMDLYMMWBF-IONNQARKSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine?
The IUPAC name of (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine (CID 178101614) is (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine.
What is the SMILES notation for (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine?
The canonical SMILES for (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine is CC[C@]1(C)C[C@H](C(F)F)CN1C.
What is the InChIKey of (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine?
The InChIKey is HEIMSMDLYMMWBF-IONNQARKSA-N. The full InChI is InChI=1S/C9H17F2N/c1-4-9(2)5-7(8(10)11)6-12(9)3/h7-8H,4-6H2,1-3H3/t7-,9+/m0/s1.
What are the key properties of (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine?
(2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine has a molecular weight of 177.24 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-4-(difluoromethyl)-2-ethyl-1,2-dimethylpyrrolidine is sourced from PubChem (CID 178101614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).