About ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol
ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol (PubChem CID 178101638) has the molecular formula C20H28F2O
and a molecular weight of 322.44 g/mol. Its IUPAC name is ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol.
Molecular Properties
| Compound Name | ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol |
| PubChem CID | 178101638 |
| Molecular Formula | C20H28F2O |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol |
| SMILES | C#Cc1cc(F)c(F)c2cc(O)cc(CC)c12.CC.CC.CC |
| InChI | InChI=1S/C14H10F2O.3C2H6/c1-3-8-5-10(17)7-11-13(8)9(4-2)6-12(15)14(11)16;3*1-2/h2,5-7,17H,3H2,1H3;3*1-2H3 |
| InChIKey | IMRCPDJIBZVMRR-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol?
The IUPAC name of ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol (CID 178101638) is ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol.
What is the SMILES notation for ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol?
The canonical SMILES for ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol is C#Cc1cc(F)c(F)c2cc(O)cc(CC)c12.CC.CC.CC.
What is the InChIKey of ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol?
The InChIKey is IMRCPDJIBZVMRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2O.3C2H6/c1-3-8-5-10(17)7-11-13(8)9(4-2)6-12(15)14(11)16;3*1-2/h2,5-7,17H,3H2,1H3;3*1-2H3.
What are the key properties of ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol?
ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol has a molecular weight of 322.44 g/mol, XLogP of 6.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-5-ethynyl-7,8-difluoronaphthalen-2-ol is sourced from PubChem (CID 178101638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).