About (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine
(5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine (PubChem CID 178101831) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine.
Molecular Properties
| Compound Name | (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine |
| PubChem CID | 178101831 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine |
| SMILES | CN1C/C(=C/F)CC(C)(C)C1 |
| InChI | InChI=1S/C9H16FN/c1-9(2)4-8(5-10)6-11(3)7-9/h5H,4,6-7H2,1-3H3/b8-5+ |
| InChIKey | RKLUXYLXQSDFEY-VMPITWQZSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine?
The IUPAC name of (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine (CID 178101831) is (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine.
What is the SMILES notation for (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine?
The canonical SMILES for (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine is CN1C/C(=C/F)CC(C)(C)C1.
What is the InChIKey of (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine?
The InChIKey is RKLUXYLXQSDFEY-VMPITWQZSA-N. The full InChI is InChI=1S/C9H16FN/c1-9(2)4-8(5-10)6-11(3)7-9/h5H,4,6-7H2,1-3H3/b8-5+.
What are the key properties of (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine?
(5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine has a molecular weight of 157.23 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-(fluoromethylidene)-1,3,3-trimethylpiperidine is sourced from PubChem (CID 178101831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).