C55H69ClF3N7O6S3Y-2 — CID 178102179
CID 178102179 (PubChem CID 178102179) has the molecular formula C55H69ClF3N7O6S3Y-2 and a molecular weight of 1201.75 g/mol.
| Compound Name | CID 178102179 |
|---|---|
| PubChem CID | 178102179 |
| Molecular Formula | C55H69ClF3N7O6S3Y-2 |
| Molecular Weight | 1201.75 g/mol |
| Exact Mass | 1200.32 |
| IUPAC Name | — |
| SMILES | NS(=O)[O-].O=C(c1ccc(N2CCN(CC3=C(c4ccc(Cl)cc4)CCC4(CCN(CC5CC[N-]CC5)CC4)C3)CC2)cc1)c1ccc(NC(CCN2CCOCC2)CSc2ccccc2)c(OOSC(F)(F)F)c1.[Y] |
| InChI | InChI=1S/C55H67ClF3N6O4S2.H3NO2S.Y/c56-46-11-6-42(7-12-46)50-16-20-54(21-26-63(27-22-54)38-41-17-23-60-24-18-41)37-45(50)39-64-28-30-65(31-29-64)48-13-8-43(9-14-48)53(66)44-10-15-51(52(36-44)68-69-71-55(57,58)59)61-47(19-25-62-32-34-67-35-33-62)40-70-49-4-2-1-3-5-49;1-4(2)3;/h1-15,36,41,47,61H,16-35,37-40H2;1H2,(H,2,3);/q-1;;/p-1 |
| InChIKey | NKHAUVPPJHOVKT-UHFFFAOYSA-M |
| XLogP | 10.71 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1201.75 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|