C15H15FN2O3 — CID 178102332
N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid (PubChem CID 178102332) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid.
| Compound Name | N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid |
|---|---|
| PubChem CID | 178102332 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid |
| SMILES | Cc1cccc(C(=O)Nc2ccc(F)cc2N)c1.O=CO |
| InChI | InChI=1S/C14H13FN2O.CH2O2/c1-9-3-2-4-10(7-9)14(18)17-13-6-5-11(15)8-12(13)16;2-1-3/h2-8H,16H2,1H3,(H,17,18);1H,(H,2,3) |
| InChIKey | YTEGURJIFDQNJY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|