N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid

C15H15FN2O3 — CID 178102332

IUPACN-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid
SMILESCc1cccc(C(=O)Nc2ccc(F)cc2N)c1.O=CO
InChIInChI=1S/C14H13FN2O.CH2O2/c1-9-3-2-4-10(7-9)14(18)17-13-6-5-11(15)8-12(13)16;2-1-3/h2-8H,16H2,1H3,(H,17,18);1H,(H,2,3)
InChIKeyYTEGURJIFDQNJY-UHFFFAOYSA-N
MW290.29 g/mol
LogP2.67
Rot. Bonds2

About N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid

N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid (PubChem CID 178102332) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid.

Molecular Properties

Compound NameN-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid
PubChem CID178102332
Molecular FormulaC15H15FN2O3
Molecular Weight290.29 g/mol
Exact Mass290.11
IUPAC NameN-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid
SMILESCc1cccc(C(=O)Nc2ccc(F)cc2N)c1.O=CO
InChIInChI=1S/C14H13FN2O.CH2O2/c1-9-3-2-4-10(7-9)14(18)17-13-6-5-11(15)8-12(13)16;2-1-3/h2-8H,16H2,1H3,(H,17,18);1H,(H,2,3)
InChIKeyYTEGURJIFDQNJY-UHFFFAOYSA-N
XLogP2.67
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.29
LogP ≤ 52.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid?
The IUPAC name of N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid (CID 178102332) is N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid.
What is the SMILES notation for N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid?
The canonical SMILES for N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid is Cc1cccc(C(=O)Nc2ccc(F)cc2N)c1.O=CO.
What is the InChIKey of N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid?
The InChIKey is YTEGURJIFDQNJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2O.CH2O2/c1-9-3-2-4-10(7-9)14(18)17-13-6-5-11(15)8-12(13)16;2-1-3/h2-8H,16H2,1H3,(H,17,18);1H,(H,2,3).
What are the key properties of N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid?
N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid has a molecular weight of 290.29 g/mol, XLogP of 2.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-4-fluorophenyl)-3-methylbenzamide;formic acid is sourced from PubChem (CID 178102332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).