About (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine
(2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine (PubChem CID 178102429) has the molecular formula C14H18FNS
and a molecular weight of 251.37 g/mol. Its IUPAC name is (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine.
Molecular Properties
| Compound Name | (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine |
| PubChem CID | 178102429 |
| Molecular Formula | C14H18FNS |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine |
| SMILES | CN1CCC[C@@H]1C[C@H]1CSc2ccc(F)cc21 |
| InChI | InChI=1S/C14H18FNS/c1-16-6-2-3-12(16)7-10-9-17-14-5-4-11(15)8-13(10)14/h4-5,8,10,12H,2-3,6-7,9H2,1H3/t10-,12+/m0/s1 |
| InChIKey | HQCNJUBYBNPHDK-CMPLNLGQSA-N |
| XLogP | 3.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine?
The IUPAC name of (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine (CID 178102429) is (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine.
What is the SMILES notation for (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine?
The canonical SMILES for (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine is CN1CCC[C@@H]1C[C@H]1CSc2ccc(F)cc21.
What is the InChIKey of (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine?
The InChIKey is HQCNJUBYBNPHDK-CMPLNLGQSA-N. The full InChI is InChI=1S/C14H18FNS/c1-16-6-2-3-12(16)7-10-9-17-14-5-4-11(15)8-13(10)14/h4-5,8,10,12H,2-3,6-7,9H2,1H3/t10-,12+/m0/s1.
What are the key properties of (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine?
(2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine has a molecular weight of 251.37 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[[(3R)-5-fluoro-2,3-dihydro-1-benzothiophen-3-yl]methyl]-1-methylpyrrolidine is sourced from PubChem (CID 178102429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).