About 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine
2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine (PubChem CID 178102637) has the molecular formula C17H24FNS
and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine |
| PubChem CID | 178102637 |
| Molecular Formula | C17H24FNS |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine |
| SMILES | CCc1ccc2c(c1)[C@](F)(CC1(C)CCCN1C)CS2 |
| InChI | InChI=1S/C17H24FNS/c1-4-13-6-7-15-14(10-13)17(18,12-20-15)11-16(2)8-5-9-19(16)3/h6-7,10H,4-5,8-9,11-12H2,1-3H3/t16?,17-/m0/s1 |
| InChIKey | KKAZQAVHDKGZOA-DJNXLDHESA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine?
The IUPAC name of 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine (CID 178102637) is 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine.
What is the SMILES notation for 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine?
The canonical SMILES for 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine is CCc1ccc2c(c1)[C@](F)(CC1(C)CCCN1C)CS2.
What is the InChIKey of 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine?
The InChIKey is KKAZQAVHDKGZOA-DJNXLDHESA-N. The full InChI is InChI=1S/C17H24FNS/c1-4-13-6-7-15-14(10-13)17(18,12-20-15)11-16(2)8-5-9-19(16)3/h6-7,10H,4-5,8-9,11-12H2,1-3H3/t16?,17-/m0/s1.
What are the key properties of 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine?
2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine has a molecular weight of 293.45 g/mol, XLogP of 4.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R)-5-ethyl-3-fluoro-2H-1-benzothiophen-3-yl]methyl]-1,2-dimethylpyrrolidine is sourced from PubChem (CID 178102637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).