C9H14N2O3 — CID 178102829
2-(3-hydroxypropoxymethyl)-4-methyl-1H-pyrimidin-6-one (PubChem CID 178102829) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-(3-hydroxypropoxymethyl)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(3-hydroxypropoxymethyl)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 178102829 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-(3-hydroxypropoxymethyl)-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(COCCCO)n1 |
| InChI | InChI=1S/C9H14N2O3/c1-7-5-9(13)11-8(10-7)6-14-4-2-3-12/h5,12H,2-4,6H2,1H3,(H,10,11,13) |
| InChIKey | QVGQHCYZVOPULN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|