C12H23NO3 — CID 178103641
2-[2-[2-[(3,3-dimethylcyclopropen-1-yl)methoxy]ethoxy]ethoxy]ethanamine (PubChem CID 178103641) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-[2-[2-[(3,3-dimethylcyclopropen-1-yl)methoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[2-[(3,3-dimethylcyclopropen-1-yl)methoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 178103641 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2-[2-[2-[(3,3-dimethylcyclopropen-1-yl)methoxy]ethoxy]ethoxy]ethanamine |
| SMILES | CC1(C)C=C1COCCOCCOCCN |
| InChI | InChI=1S/C12H23NO3/c1-12(2)9-11(12)10-16-8-7-15-6-5-14-4-3-13/h9H,3-8,10,13H2,1-2H3 |
| InChIKey | MQPQQQZEQYAHRA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|