About N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine
N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine (PubChem CID 178103991) has the molecular formula C8H9FN4
and a molecular weight of 180.19 g/mol. Its IUPAC name is N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine.
Molecular Properties
| Compound Name | N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine |
| PubChem CID | 178103991 |
| Molecular Formula | C8H9FN4 |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine |
| SMILES | Cc1cn2cc(N(C)F)nc2cn1 |
| InChI | InChI=1S/C8H9FN4/c1-6-4-13-5-8(12(2)9)11-7(13)3-10-6/h3-5H,1-2H3 |
| InChIKey | RGCPSAPTQGRLQT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine?
The IUPAC name of N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine (CID 178103991) is N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine.
What is the SMILES notation for N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine?
The canonical SMILES for N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine is Cc1cn2cc(N(C)F)nc2cn1.
What is the InChIKey of N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine?
The InChIKey is RGCPSAPTQGRLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN4/c1-6-4-13-5-8(12(2)9)11-7(13)3-10-6/h3-5H,1-2H3.
What are the key properties of N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine?
N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine has a molecular weight of 180.19 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-fluoro-N,6-dimethylimidazo[1,2-a]pyrazin-2-amine is sourced from PubChem (CID 178103991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).