About ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine
ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine (PubChem CID 178104345) has the molecular formula C16H31NS
and a molecular weight of 269.50 g/mol. Its IUPAC name is ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine.
Molecular Properties
| Compound Name | ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine |
| PubChem CID | 178104345 |
| Molecular Formula | C16H31NS |
| Molecular Weight | 269.50 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine |
| SMILES | C=S1(=C)CCC(N(C)CC#CC(C)C)CC1.CC |
| InChI | InChI=1S/C14H25NS.C2H6/c1-13(2)7-6-10-15(3)14-8-11-16(4,5)12-9-14;1-2/h13-14H,4-5,8-12H2,1-3H3;1-2H3 |
| InChIKey | ALEGBWOWSIMJII-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine?
The IUPAC name of ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine (CID 178104345) is ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine.
What is the SMILES notation for ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine?
The canonical SMILES for ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine is C=S1(=C)CCC(N(C)CC#CC(C)C)CC1.CC.
What is the InChIKey of ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine?
The InChIKey is ALEGBWOWSIMJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NS.C2H6/c1-13(2)7-6-10-15(3)14-8-11-16(4,5)12-9-14;1-2/h13-14H,4-5,8-12H2,1-3H3;1-2H3.
What are the key properties of ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine?
ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine has a molecular weight of 269.50 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-1,1-dimethylidene-N-(4-methylpent-2-ynyl)thian-4-amine is sourced from PubChem (CID 178104345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).