About CID 178104928
CID 178104928 (PubChem CID 178104928) has the molecular formula C19H34N5ORe-
and a molecular weight of 534.72 g/mol.
Molecular Properties
| Compound Name | CID 178104928 |
| PubChem CID | 178104928 |
| Molecular Formula | C19H34N5ORe- |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | — |
| SMILES | CC.CC.CC.Cc1nc2c3c(nn(C)c3n1)O[CH-]C1CCCCN21.[Re] |
| InChI | InChI=1S/C13H16N5O.3C2H6.Re/c1-8-14-11-10-12(15-8)18-6-4-3-5-9(18)7-19-13(10)16-17(11)2;3*1-2;/h7,9H,3-6H2,1-2H3;3*1-2H3;/q-1;;;; |
| InChIKey | RETKHHIRJAGQGX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 178104928 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178104928?
The IUPAC name of CID 178104928 (CID 178104928) is not available.
What is the SMILES notation for CID 178104928?
The canonical SMILES for CID 178104928 is CC.CC.CC.Cc1nc2c3c(nn(C)c3n1)O[CH-]C1CCCCN21.[Re].
What is the InChIKey of CID 178104928?
The InChIKey is RETKHHIRJAGQGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N5O.3C2H6.Re/c1-8-14-11-10-12(15-8)18-6-4-3-5-9(18)7-19-13(10)16-17(11)2;3*1-2;/h7,9H,3-6H2,1-2H3;3*1-2H3;/q-1;;;;.
What are the key properties of CID 178104928?
CID 178104928 has a molecular weight of 534.72 g/mol, XLogP of 4.66, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178104928 is sourced from PubChem (CID 178104928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).