C13H17N5O — CID 178104929
12,15-dimethyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene (PubChem CID 178104929) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 12,15-dimethyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene.
| Compound Name | 12,15-dimethyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene |
|---|---|
| PubChem CID | 178104929 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 12,15-dimethyl-9-oxa-2,11,12,14,16-pentazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),10,13(17),14-tetraene |
| SMILES | Cc1nc2c3c(nn(C)c3n1)OCC1CCCCN21 |
| InChI | InChI=1S/C13H17N5O/c1-8-14-11-10-12(15-8)18-6-4-3-5-9(18)7-19-13(10)16-17(11)2/h9H,3-7H2,1-2H3 |
| InChIKey | RFONOJRSWFGUBQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |