C9H11N5 — CID 178104944
4-(2-methylazetidin-1-yl)-1H-pyrazolo[5,4-d]pyrimidine (PubChem CID 178104944) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-(2-methylazetidin-1-yl)-1H-pyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-(2-methylazetidin-1-yl)-1H-pyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 178104944 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 4-(2-methylazetidin-1-yl)-1H-pyrazolo[5,4-d]pyrimidine |
| SMILES | CC1CCN1c1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C9H11N5/c1-6-2-3-14(6)9-7-4-12-13-8(7)10-5-11-9/h4-6H,2-3H2,1H3,(H,10,11,12,13) |
| InChIKey | URQUSDHSKLNHGK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |