About CID 178105027
CID 178105027 (PubChem CID 178105027) has the molecular formula C15H24N5ORe2-
and a molecular weight of 662.80 g/mol.
Molecular Properties
| Compound Name | CID 178105027 |
| PubChem CID | 178105027 |
| Molecular Formula | C15H24N5ORe2- |
| Molecular Weight | 662.80 g/mol |
| Exact Mass | 664.11 |
| IUPAC Name | — |
| SMILES | CC.CCCC1[CH-]Oc2n[nH]c3ncnc(c23)N1CCC.[Re].[Re] |
| InChI | InChI=1S/C13H18N5O.C2H6.2Re/c1-3-5-9-7-19-13-10-11(16-17-13)14-8-15-12(10)18(9)6-4-2;1-2;;/h7-9H,3-6H2,1-2H3,(H,14,15,16,17);1-2H3;;/q-1;;; |
| InChIKey | GKDNBBFGJNGZTM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 662.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 178105027 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178105027?
The IUPAC name of CID 178105027 (CID 178105027) is not available.
What is the SMILES notation for CID 178105027?
The canonical SMILES for CID 178105027 is CC.CCCC1[CH-]Oc2n[nH]c3ncnc(c23)N1CCC.[Re].[Re].
What is the InChIKey of CID 178105027?
The InChIKey is GKDNBBFGJNGZTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N5O.C2H6.2Re/c1-3-5-9-7-19-13-10-11(16-17-13)14-8-15-12(10)18(9)6-4-2;1-2;;/h7-9H,3-6H2,1-2H3,(H,14,15,16,17);1-2H3;;/q-1;;;.
What are the key properties of CID 178105027?
CID 178105027 has a molecular weight of 662.80 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178105027 is sourced from PubChem (CID 178105027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).