About CID 178105762
CID 178105762 (PubChem CID 178105762) has the molecular formula C42H62BN7O7
and a molecular weight of 787.81 g/mol.
Molecular Properties
| Compound Name | CID 178105762 |
| PubChem CID | 178105762 |
| Molecular Formula | C42H62BN7O7 |
| Molecular Weight | 787.81 g/mol |
| Exact Mass | 787.48 |
| IUPAC Name | — |
| SMILES | C=C[C@@H]([C@@H]1CCCN1C)n1nc(CC)c2c(N3C[C@](C)(O)CC[C@@H]3CCB3OC(C)(C)C(C)(C)O3)nc(-c3noc4c3CCOC43CCCCC34OCCO4)nc21 |
| InChI | InChI=1S/C42H62BN7O7/c1-9-29-32-36(49-26-40(7,51)20-15-27(49)16-21-43-56-38(3,4)39(5,6)57-43)44-35(45-37(32)50(46-29)30(10-2)31-14-13-22-48(31)8)33-28-17-23-52-41(34(28)55-47-33)18-11-12-19-42(41)53-24-25-54-42/h10,27,30-31,51H,2,9,11-26H2,1,3-8H3/t27-,30+,31+,40-,41?/m1/s1 |
| InChIKey | HKDKLKCYFPSQPH-PQDSBDKBSA-N |
| XLogP | 6.15 |
| TPSA | 142.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 787.81 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 178105762 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178105762?
The IUPAC name of CID 178105762 (CID 178105762) is not available.
What is the SMILES notation for CID 178105762?
The canonical SMILES for CID 178105762 is C=C[C@@H]([C@@H]1CCCN1C)n1nc(CC)c2c(N3C[C@](C)(O)CC[C@@H]3CCB3OC(C)(C)C(C)(C)O3)nc(-c3noc4c3CCOC43CCCCC34OCCO4)nc21.
What is the InChIKey of CID 178105762?
The InChIKey is HKDKLKCYFPSQPH-PQDSBDKBSA-N. The full InChI is InChI=1S/C42H62BN7O7/c1-9-29-32-36(49-26-40(7,51)20-15-27(49)16-21-43-56-38(3,4)39(5,6)57-43)44-35(45-37(32)50(46-29)30(10-2)31-14-13-22-48(31)8)33-28-17-23-52-41(34(28)55-47-33)18-11-12-19-42(41)53-24-25-54-42/h10,27,30-31,51H,2,9,11-26H2,1,3-8H3/t27-,30+,31+,40-,41?/m1/s1.
What are the key properties of CID 178105762?
CID 178105762 has a molecular weight of 787.81 g/mol, XLogP of 6.15, 9 rotatable bonds, 1 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178105762 is sourced from PubChem (CID 178105762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).