About CID 178106004
CID 178106004 (PubChem CID 178106004) has the molecular formula C33H45IN8O5
and a molecular weight of 760.68 g/mol.
Molecular Properties
| Compound Name | CID 178106004 |
| PubChem CID | 178106004 |
| Molecular Formula | C33H45IN8O5 |
| Molecular Weight | 760.68 g/mol |
| Exact Mass | 760.26 |
| IUPAC Name | — |
| SMILES | C[C@@H]([C@@H]1CCCN1C)n1nc(I)c2c(N3C[C@](C)(O)CC[C@@H]3C(N)=O)nc(-c3noc4c3CCC[C@@]43CCCCC34OCCO4)nc21 |
| InChI | InChI=1S/C33H45IN8O5/c1-19(21-9-7-15-40(21)3)42-30-23(26(34)38-42)29(41-18-31(2,44)14-10-22(41)27(35)43)36-28(37-30)24-20-8-6-12-32(25(20)47-39-24)11-4-5-13-33(32)45-16-17-46-33/h19,21-22,44H,4-18H2,1-3H3,(H2,35,43)/t19-,21-,22+,31+,32-/m0/s1 |
| InChIKey | NYWNDYINSIFOKA-KEWWKIHNSA-N |
| XLogP | 3.84 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 760.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 178106004 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178106004?
The IUPAC name of CID 178106004 (CID 178106004) is not available.
What is the SMILES notation for CID 178106004?
The canonical SMILES for CID 178106004 is C[C@@H]([C@@H]1CCCN1C)n1nc(I)c2c(N3C[C@](C)(O)CC[C@@H]3C(N)=O)nc(-c3noc4c3CCC[C@@]43CCCCC34OCCO4)nc21.
What is the InChIKey of CID 178106004?
The InChIKey is NYWNDYINSIFOKA-KEWWKIHNSA-N. The full InChI is InChI=1S/C33H45IN8O5/c1-19(21-9-7-15-40(21)3)42-30-23(26(34)38-42)29(41-18-31(2,44)14-10-22(41)27(35)43)36-28(37-30)24-20-8-6-12-32(25(20)47-39-24)11-4-5-13-33(32)45-16-17-46-33/h19,21-22,44H,4-18H2,1-3H3,(H2,35,43)/t19-,21-,22+,31+,32-/m0/s1.
What are the key properties of CID 178106004?
CID 178106004 has a molecular weight of 760.68 g/mol, XLogP of 3.84, 5 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178106004 is sourced from PubChem (CID 178106004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).