C14H20N6O2 — CID 178106336
3,10-dimethyl-9-(5-methyloxolan-3-yl)-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-6-amine (PubChem CID 178106336) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3,10-dimethyl-9-(5-methyloxolan-3-yl)-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-6-amine.
| Compound Name | 3,10-dimethyl-9-(5-methyloxolan-3-yl)-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-6-amine |
|---|---|
| PubChem CID | 178106336 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3,10-dimethyl-9-(5-methyloxolan-3-yl)-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-6-amine |
| SMILES | CC1CC(N2c3nc(N)nc4c3c(nn4C)OCC2C)CO1 |
| InChI | InChI=1S/C14H20N6O2/c1-7-5-22-13-10-11(19(3)18-13)16-14(15)17-12(10)20(7)9-4-8(2)21-6-9/h7-9H,4-6H2,1-3H3,(H2,15,16,17) |
| InChIKey | LNMYQAPTGTYZPZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |