About CID 178106504
CID 178106504 (PubChem CID 178106504) has the molecular formula C27H33ClN6O4
and a molecular weight of 541.05 g/mol.
Molecular Properties
| Compound Name | CID 178106504 |
| PubChem CID | 178106504 |
| Molecular Formula | C27H33ClN6O4 |
| Molecular Weight | 541.05 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | — |
| SMILES | C[C@@H]([C@@H]1CCCN1C)n1nc(C=O)c2c(Cl)nc(-c3noc4c3CCC[C@@]43CCCCC34OCCO4)nc21 |
| InChI | InChI=1S/C27H33ClN6O4/c1-16(19-8-6-12-33(19)2)34-25-20(18(15-35)31-34)23(28)29-24(30-25)21-17-7-5-10-26(22(17)38-32-21)9-3-4-11-27(26)36-13-14-37-27/h15-16,19H,3-14H2,1-2H3/t16-,19-,26-/m0/s1 |
| InChIKey | WTDYQDYKFDFXET-VONMNZPZSA-N |
| XLogP | 4.49 |
| TPSA | 108.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 541.05 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze CID 178106504 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178106504?
The IUPAC name of CID 178106504 (CID 178106504) is not available.
What is the SMILES notation for CID 178106504?
The canonical SMILES for CID 178106504 is C[C@@H]([C@@H]1CCCN1C)n1nc(C=O)c2c(Cl)nc(-c3noc4c3CCC[C@@]43CCCCC34OCCO4)nc21.
What is the InChIKey of CID 178106504?
The InChIKey is WTDYQDYKFDFXET-VONMNZPZSA-N. The full InChI is InChI=1S/C27H33ClN6O4/c1-16(19-8-6-12-33(19)2)34-25-20(18(15-35)31-34)23(28)29-24(30-25)21-17-7-5-10-26(22(17)38-32-21)9-3-4-11-27(26)36-13-14-37-27/h15-16,19H,3-14H2,1-2H3/t16-,19-,26-/m0/s1.
What are the key properties of CID 178106504?
CID 178106504 has a molecular weight of 541.05 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178106504 is sourced from PubChem (CID 178106504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).