C17H30O5 — CID 178106604
ethane;methyl 6-pent-4-enoxy-1,4-dioxaspiro[4.5]decane-6-carboxylate (PubChem CID 178106604) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is ethane;methyl 6-pent-4-enoxy-1,4-dioxaspiro[4.5]decane-6-carboxylate.
| Compound Name | ethane;methyl 6-pent-4-enoxy-1,4-dioxaspiro[4.5]decane-6-carboxylate |
|---|---|
| PubChem CID | 178106604 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | ethane;methyl 6-pent-4-enoxy-1,4-dioxaspiro[4.5]decane-6-carboxylate |
| SMILES | C=CCCCOC1(C(=O)OC)CCCCC12OCCO2.CC |
| InChI | InChI=1S/C15H24O5.C2H6/c1-3-4-7-10-18-14(13(16)17-2)8-5-6-9-15(14)19-11-12-20-15;1-2/h3H,1,4-12H2,2H3;1-2H3 |
| InChIKey | CXUNSLYQINVGNA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|