About CID 178106918
CID 178106918 (PubChem CID 178106918) has the molecular formula C13H18BN5O3
and a molecular weight of 303.13 g/mol.
Molecular Properties
| Compound Name | CID 178106918 |
| PubChem CID | 178106918 |
| Molecular Formula | C13H18BN5O3 |
| Molecular Weight | 303.13 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | — |
| SMILES | [B]C(O)Oc1n[nH]c2nc(C)nc(N3CCC[C@](C)(O)C3)c12 |
| InChI | InChI=1S/C13H18BN5O3/c1-7-15-9-8(11(18-17-9)22-12(14)20)10(16-7)19-5-3-4-13(2,21)6-19/h12,20-21H,3-6H2,1-2H3,(H,15,16,17,18)/t12?,13-/m0/s1 |
| InChIKey | HANRKIRCGBWZMB-ABLWVSNPSA-N |
| XLogP | -0.16 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.13 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 178106918 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178106918?
The IUPAC name of CID 178106918 (CID 178106918) is not available.
What is the SMILES notation for CID 178106918?
The canonical SMILES for CID 178106918 is [B]C(O)Oc1n[nH]c2nc(C)nc(N3CCC[C@](C)(O)C3)c12.
What is the InChIKey of CID 178106918?
The InChIKey is HANRKIRCGBWZMB-ABLWVSNPSA-N. The full InChI is InChI=1S/C13H18BN5O3/c1-7-15-9-8(11(18-17-9)22-12(14)20)10(16-7)19-5-3-4-13(2,21)6-19/h12,20-21H,3-6H2,1-2H3,(H,15,16,17,18)/t12?,13-/m0/s1.
What are the key properties of CID 178106918?
CID 178106918 has a molecular weight of 303.13 g/mol, XLogP of -0.16, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178106918 is sourced from PubChem (CID 178106918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).