C17H23N7O — CID 178107066
ethane;3-[(1R)-1-(6-methyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-9-yl)ethyl]pyridin-2-amine (PubChem CID 178107066) has the molecular formula C17H23N7O and a molecular weight of 341.42 g/mol. Its IUPAC name is ethane;3-[(1R)-1-(6-methyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-9-yl)ethyl]pyridin-2-amine.
| Compound Name | ethane;3-[(1R)-1-(6-methyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-9-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 178107066 |
| Molecular Formula | C17H23N7O |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | ethane;3-[(1R)-1-(6-methyl-12-oxa-2,3,5,7,9-pentazatricyclo[6.4.1.04,13]trideca-1,4(13),5,7-tetraen-9-yl)ethyl]pyridin-2-amine |
| SMILES | CC.Cc1nc2c3c(n[nH]c3n1)OCCN2[C@H](C)c1cccnc1N |
| InChI | InChI=1S/C15H17N7O.C2H6/c1-8(10-4-3-5-17-12(10)16)22-6-7-23-15-11-13(20-21-15)18-9(2)19-14(11)22;1-2/h3-5,8H,6-7H2,1-2H3,(H2,16,17)(H,18,19,20,21);1-2H3/t8-;/m1./s1 |
| InChIKey | MWOMIDGKGWMXGE-DDWIOCJRSA-N |
| XLogP | 2.62 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |