C12H20O4 — CID 178107409
1,4-dioxaspiro[4.5]decane-6-carboxylic acid;prop-1-ene (PubChem CID 178107409) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.5]decane-6-carboxylic acid;prop-1-ene.
| Compound Name | 1,4-dioxaspiro[4.5]decane-6-carboxylic acid;prop-1-ene |
|---|---|
| PubChem CID | 178107409 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1,4-dioxaspiro[4.5]decane-6-carboxylic acid;prop-1-ene |
| SMILES | C=CC.O=C(O)C1CCCCC12OCCO2 |
| InChI | InChI=1S/C9H14O4.C3H6/c10-8(11)7-3-1-2-4-9(7)12-5-6-13-9;1-3-2/h7H,1-6H2,(H,10,11);3H,1H2,2H3 |
| InChIKey | YEUHRZPZOVHMKP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|