C30H53N5O4S4 — CID 178108062
2-[[(2S)-2-ethylhexyl]disulfanyl]ethyl N-[(3R)-1-[2-[2-[[(2S)-2-ethylhexyl]disulfanyl]ethoxycarbonylamino]pyrimidin-4-yl]pyrrolidin-3-yl]carbamate (PubChem CID 178108062) has the molecular formula C30H53N5O4S4 and a molecular weight of 676.05 g/mol. Its IUPAC name is 2-[[(2S)-2-ethylhexyl]disulfanyl]ethyl N-[(3R)-1-[2-[2-[[(2S)-2-ethylhexyl]disulfanyl]ethoxycarbonylamino]pyrimidin-4-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | 2-[[(2S)-2-ethylhexyl]disulfanyl]ethyl N-[(3R)-1-[2-[2-[[(2S)-2-ethylhexyl]disulfanyl]ethoxycarbonylamino]pyrimidin-4-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 178108062 |
| Molecular Formula | C30H53N5O4S4 |
| Molecular Weight | 676.05 g/mol |
| Exact Mass | 675.30 |
| IUPAC Name | 2-[[(2S)-2-ethylhexyl]disulfanyl]ethyl N-[(3R)-1-[2-[2-[[(2S)-2-ethylhexyl]disulfanyl]ethoxycarbonylamino]pyrimidin-4-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CCCC[C@H](CC)CSSCCOC(=O)Nc1nccc(N2CC[C@@H](NC(=O)OCCSSC[C@@H](CC)CCCC)C2)n1 |
| InChI | InChI=1S/C30H53N5O4S4/c1-5-9-11-24(7-3)22-42-40-19-17-38-29(36)32-26-14-16-35(21-26)27-13-15-31-28(33-27)34-30(37)39-18-20-41-43-23-25(8-4)12-10-6-2/h13,15,24-26H,5-12,14,16-23H2,1-4H3,(H,32,36)(H,31,33,34,37)/t24-,25-,26+/m0/s1 |
| InChIKey | YQJJIIJIPPCRLG-KKUQBAQOSA-N |
| XLogP | 8.53 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.05 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|