About CID 178108174
CID 178108174 (PubChem CID 178108174) has the molecular formula C20H25BN4O3
and a molecular weight of 380.26 g/mol.
Molecular Properties
| Compound Name | CID 178108174 |
| PubChem CID | 178108174 |
| Molecular Formula | C20H25BN4O3 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | — |
| SMILES | [B]c1cnc2[nH]c3c(c(=O)c2n1)C1(CCN(C(=O)OC(C)(C)C)CC1)C[C@@H]3C |
| InChI | InChI=1S/C20H25BN4O3/c1-11-9-20(5-7-25(8-6-20)18(27)28-19(2,3)4)13-14(11)24-17-15(16(13)26)23-12(21)10-22-17/h10-11H,5-9H2,1-4H3,(H,22,24,26)/t11-/m0/s1 |
| InChIKey | QAPDRCZJHSMGMF-NSHDSACASA-N |
| XLogP | 1.89 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178108174 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178108174?
The IUPAC name of CID 178108174 (CID 178108174) is not available.
What is the SMILES notation for CID 178108174?
The canonical SMILES for CID 178108174 is [B]c1cnc2[nH]c3c(c(=O)c2n1)C1(CCN(C(=O)OC(C)(C)C)CC1)C[C@@H]3C.
What is the InChIKey of CID 178108174?
The InChIKey is QAPDRCZJHSMGMF-NSHDSACASA-N. The full InChI is InChI=1S/C20H25BN4O3/c1-11-9-20(5-7-25(8-6-20)18(27)28-19(2,3)4)13-14(11)24-17-15(16(13)26)23-12(21)10-22-17/h10-11H,5-9H2,1-4H3,(H,22,24,26)/t11-/m0/s1.
What are the key properties of CID 178108174?
CID 178108174 has a molecular weight of 380.26 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178108174 is sourced from PubChem (CID 178108174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).