C16H27F3N2O — CID 178108409
(10aR)-9-[ethyl(4,4,4-trifluorobutyl)amino]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-5-one (PubChem CID 178108409) has the molecular formula C16H27F3N2O and a molecular weight of 320.40 g/mol. Its IUPAC name is (10aR)-9-[ethyl(4,4,4-trifluorobutyl)amino]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-5-one.
| Compound Name | (10aR)-9-[ethyl(4,4,4-trifluorobutyl)amino]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-5-one |
|---|---|
| PubChem CID | 178108409 |
| Molecular Formula | C16H27F3N2O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (10aR)-9-[ethyl(4,4,4-trifluorobutyl)amino]-2,3,6,7,8,9,10,10a-octahydro-1H-pyrrolo[1,2-a]azocin-5-one |
| SMILES | CCN(CCCC(F)(F)F)C1CCCC(=O)N2CCC[C@@H]2C1 |
| InChI | InChI=1S/C16H27F3N2O/c1-2-20(10-5-9-16(17,18)19)13-6-3-8-15(22)21-11-4-7-14(21)12-13/h13-14H,2-12H2,1H3/t13?,14-/m1/s1 |
| InChIKey | DKRPRSUVQBYBMX-ARLHGKGLSA-N |
| XLogP | 3.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |