C27H30N6O3 — CID 178108922
methyl N-(methylcarbamoyl)-N-[4-[3-methyl-2-[4-methyl-3-(3-methylphenyl)-2-oxoimidazolidin-1-yl]-4-pyridinyl]phenyl]carbamimidate (PubChem CID 178108922) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is methyl N-(methylcarbamoyl)-N-[4-[3-methyl-2-[4-methyl-3-(3-methylphenyl)-2-oxoimidazolidin-1-yl]-4-pyridinyl]phenyl]carbamimidate.
| Compound Name | methyl N-(methylcarbamoyl)-N-[4-[3-methyl-2-[4-methyl-3-(3-methylphenyl)-2-oxoimidazolidin-1-yl]-4-pyridinyl]phenyl]carbamimidate |
|---|---|
| PubChem CID | 178108922 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | methyl N-(methylcarbamoyl)-N-[4-[3-methyl-2-[4-methyl-3-(3-methylphenyl)-2-oxoimidazolidin-1-yl]-4-pyridinyl]phenyl]carbamimidate |
| SMILES | [H]/N=C(\OC)N(C(=O)NC)c1ccc(-c2ccnc(N3CC(C)N(c4cccc(C)c4)C3=O)c2C)cc1 |
| InChI | InChI=1S/C27H30N6O3/c1-17-7-6-8-22(15-17)32-18(2)16-31(27(32)35)24-19(3)23(13-14-30-24)20-9-11-21(12-10-20)33(25(28)36-5)26(34)29-4/h6-15,18,28H,16H2,1-5H3,(H,29,34)/b28-25- |
| InChIKey | CDWBDZXFLAGXDA-FVDSYPCUSA-N |
| XLogP | 4.93 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|