About 4-ethyl-1-methyl-2,3-dihydro-1H-indene
4-ethyl-1-methyl-2,3-dihydro-1H-indene (PubChem CID 178109031) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 4-ethyl-1-methyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 4-ethyl-1-methyl-2,3-dihydro-1H-indene |
| PubChem CID | 178109031 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 4-ethyl-1-methyl-2,3-dihydro-1H-indene |
| SMILES | CCc1cccc2c1CCC2C |
| InChI | InChI=1S/C12H16/c1-3-10-5-4-6-11-9(2)7-8-12(10)11/h4-6,9H,3,7-8H2,1-2H3 |
| InChIKey | CRLKJHRPNKTECX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-ethyl-1-methyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-methyl-2,3-dihydro-1H-indene?
The IUPAC name of 4-ethyl-1-methyl-2,3-dihydro-1H-indene (CID 178109031) is 4-ethyl-1-methyl-2,3-dihydro-1H-indene.
What is the SMILES notation for 4-ethyl-1-methyl-2,3-dihydro-1H-indene?
The canonical SMILES for 4-ethyl-1-methyl-2,3-dihydro-1H-indene is CCc1cccc2c1CCC2C.
What is the InChIKey of 4-ethyl-1-methyl-2,3-dihydro-1H-indene?
The InChIKey is CRLKJHRPNKTECX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-3-10-5-4-6-11-9(2)7-8-12(10)11/h4-6,9H,3,7-8H2,1-2H3.
What are the key properties of 4-ethyl-1-methyl-2,3-dihydro-1H-indene?
4-ethyl-1-methyl-2,3-dihydro-1H-indene has a molecular weight of 160.26 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-methyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 178109031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).