C19H25NO6 — CID 178110042
ditert-butyl 5-methoxy-1-oxo-3H-isoindole-2,4-dicarboxylate (PubChem CID 178110042) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is ditert-butyl 5-methoxy-1-oxo-3H-isoindole-2,4-dicarboxylate.
| Compound Name | ditert-butyl 5-methoxy-1-oxo-3H-isoindole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 178110042 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | ditert-butyl 5-methoxy-1-oxo-3H-isoindole-2,4-dicarboxylate |
| SMILES | COc1ccc2c(c1C(=O)OC(C)(C)C)CN(C(=O)OC(C)(C)C)C2=O |
| InChI | InChI=1S/C19H25NO6/c1-18(2,3)25-16(22)14-12-10-20(17(23)26-19(4,5)6)15(21)11(12)8-9-13(14)24-7/h8-9H,10H2,1-7H3 |
| InChIKey | JHESHHLHECXCFZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |