About 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran
4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran (PubChem CID 178110207) has the molecular formula C14H14O
and a molecular weight of 198.26 g/mol. Its IUPAC name is 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran.
Molecular Properties
| Compound Name | 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran |
| PubChem CID | 178110207 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran |
| SMILES | Cc1cccc2c1OC1C=CCC=CC21 |
| InChI | InChI=1S/C14H14O/c1-10-6-5-8-12-11-7-3-2-4-9-13(11)15-14(10)12/h3-9,11,13H,2H2,1H3 |
| InChIKey | QKNYMKYLBVTCLS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran?
The IUPAC name of 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran (CID 178110207) is 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran.
What is the SMILES notation for 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran?
The canonical SMILES for 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran is Cc1cccc2c1OC1C=CCC=CC21.
What is the InChIKey of 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran?
The InChIKey is QKNYMKYLBVTCLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O/c1-10-6-5-8-12-11-7-3-2-4-9-13(11)15-14(10)12/h3-9,11,13H,2H2,1H3.
What are the key properties of 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran?
4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran has a molecular weight of 198.26 g/mol, XLogP of 3.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-8,10a-dihydro-5aH-cyclohepta[b][1]benzofuran is sourced from PubChem (CID 178110207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).