C36H15B7N2O — CID 178110279
CID 178110279 (PubChem CID 178110279) has the molecular formula C36H15B7N2O and a molecular weight of 567.21 g/mol.
| Compound Name | CID 178110279 |
|---|---|
| PubChem CID | 178110279 |
| Molecular Formula | C36H15B7N2O |
| Molecular Weight | 567.21 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(oc3c([B])c(-c4ccc5[nH]c6ccc7c(c8ccccc8n7-c7ccccc7)c6c5c4)c([B])c([B])c32)c1[B] |
| InChI | InChI=1S/C36H15B7N2O/c37-28-23(31(40)35-26(29(28)38)27-30(39)32(41)33(42)34(43)36(27)46-35)15-10-11-19-18(14-15)24-20(44-19)12-13-22-25(24)17-8-4-5-9-21(17)45(22)16-6-2-1-3-7-16/h1-14,44H |
| InChIKey | ZEKOKMGKTPNJKI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 33.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|