C27H34N2O4S — CID 178110631
N-[(1-benzylpiperidin-3-yl)methyl]-7-methoxy-N-(2-methoxyethyl)naphthalene-2-sulfonamide (PubChem CID 178110631) has the molecular formula C27H34N2O4S and a molecular weight of 482.65 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-3-yl)methyl]-7-methoxy-N-(2-methoxyethyl)naphthalene-2-sulfonamide.
| Compound Name | N-[(1-benzylpiperidin-3-yl)methyl]-7-methoxy-N-(2-methoxyethyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 178110631 |
| Molecular Formula | C27H34N2O4S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N-[(1-benzylpiperidin-3-yl)methyl]-7-methoxy-N-(2-methoxyethyl)naphthalene-2-sulfonamide |
| SMILES | COCCN(CC1CCCN(Cc2ccccc2)C1)S(=O)(=O)c1ccc2ccc(OC)cc2c1 |
| InChI | InChI=1S/C27H34N2O4S/c1-32-16-15-29(21-23-9-6-14-28(20-23)19-22-7-4-3-5-8-22)34(30,31)27-13-11-24-10-12-26(33-2)17-25(24)18-27/h3-5,7-8,10-13,17-18,23H,6,9,14-16,19-21H2,1-2H3 |
| InChIKey | PNMIYWXEFVPOPP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |