C27H42FN7O — CID 178110706
(2E)-N-cyclohexyl-2-(4-fluoro-1-methylpiperidin-4-yl)-2-hydrazinylideneethanimine;4-methyl-3-[(3-propan-2-ylphenoxy)methyl]-1,2,4-triazole (PubChem CID 178110706) has the molecular formula C27H42FN7O and a molecular weight of 499.68 g/mol. Its IUPAC name is (2E)-N-cyclohexyl-2-(4-fluoro-1-methylpiperidin-4-yl)-2-hydrazinylideneethanimine;4-methyl-3-[(3-propan-2-ylphenoxy)methyl]-1,2,4-triazole.
| Compound Name | (2E)-N-cyclohexyl-2-(4-fluoro-1-methylpiperidin-4-yl)-2-hydrazinylideneethanimine;4-methyl-3-[(3-propan-2-ylphenoxy)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 178110706 |
| Molecular Formula | C27H42FN7O |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | (2E)-N-cyclohexyl-2-(4-fluoro-1-methylpiperidin-4-yl)-2-hydrazinylideneethanimine;4-methyl-3-[(3-propan-2-ylphenoxy)methyl]-1,2,4-triazole |
| SMILES | CC(C)c1cccc(OCc2nncn2C)c1.CN1CCC(F)(C(/C=N/C2CCCCC2)=N/N)CC1 |
| InChI | InChI=1S/C14H25FN4.C13H17N3O/c1-19-9-7-14(15,8-10-19)13(18-16)11-17-12-5-3-2-4-6-12;1-10(2)11-5-4-6-12(7-11)17-8-13-15-14-9-16(13)3/h11-12H,2-10,16H2,1H3;4-7,9-10H,8H2,1-3H3/b17-11+,18-13+; |
| InChIKey | WUUZGPFWPVTBET-QWDDUOLPSA-N |
| XLogP | 4.66 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|