About CID 178111479
CID 178111479 (PubChem CID 178111479) has the molecular formula C13H12N3OPb
and a molecular weight of 433.46 g/mol.
Molecular Properties
| Compound Name | CID 178111479 |
| PubChem CID | 178111479 |
| Molecular Formula | C13H12N3OPb |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | — |
| SMILES | N#CCc1cnn(-c2cccc(COC[Pb])c2)c1 |
| InChI | InChI=1S/C13H12N3O.Pb/c1-17-10-11-3-2-4-13(7-11)16-9-12(5-6-14)8-15-16;/h2-4,7-9H,1,5,10H2; |
| InChIKey | UCNPWHVLCKHAOE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 178111479 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178111479?
The IUPAC name of CID 178111479 (CID 178111479) is not available.
What is the SMILES notation for CID 178111479?
The canonical SMILES for CID 178111479 is N#CCc1cnn(-c2cccc(COC[Pb])c2)c1.
What is the InChIKey of CID 178111479?
The InChIKey is UCNPWHVLCKHAOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N3O.Pb/c1-17-10-11-3-2-4-13(7-11)16-9-12(5-6-14)8-15-16;/h2-4,7-9H,1,5,10H2;.
What are the key properties of CID 178111479?
CID 178111479 has a molecular weight of 433.46 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178111479 is sourced from PubChem (CID 178111479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).