C10H4ClF3N2O2 — CID 178112442
4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]-2-fluorobenzoyl chloride (PubChem CID 178112442) has the molecular formula C10H4ClF3N2O2 and a molecular weight of 276.60 g/mol. Its IUPAC name is 4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]-2-fluorobenzoyl chloride.
| Compound Name | 4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]-2-fluorobenzoyl chloride |
|---|---|
| PubChem CID | 178112442 |
| Molecular Formula | C10H4ClF3N2O2 |
| Molecular Weight | 276.60 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | 4-[5-(difluoromethyl)-1,2,4-oxadiazol-3-yl]-2-fluorobenzoyl chloride |
| SMILES | O=C(Cl)c1ccc(-c2noc(C(F)F)n2)cc1F |
| InChI | InChI=1S/C10H4ClF3N2O2/c11-7(17)5-2-1-4(3-6(5)12)9-15-10(8(13)14)18-16-9/h1-3,8H |
| InChIKey | VRSSYLQXZGBUEK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.60 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|