About 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine
6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine (PubChem CID 178113169) has the molecular formula C8H7BrFN3S
and a molecular weight of 276.13 g/mol. Its IUPAC name is 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine.
Molecular Properties
| Compound Name | 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine |
| PubChem CID | 178113169 |
| Molecular Formula | C8H7BrFN3S |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine |
| SMILES | Fc1cncnc1N1C=C(Br)SCC1 |
| InChI | InChI=1S/C8H7BrFN3S/c9-7-4-13(1-2-14-7)8-6(10)3-11-5-12-8/h3-5H,1-2H2 |
| InChIKey | UUMPQGDGQMQHGL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine?
The IUPAC name of 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine (CID 178113169) is 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine.
What is the SMILES notation for 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine?
The canonical SMILES for 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine is Fc1cncnc1N1C=C(Br)SCC1.
What is the InChIKey of 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine?
The InChIKey is UUMPQGDGQMQHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrFN3S/c9-7-4-13(1-2-14-7)8-6(10)3-11-5-12-8/h3-5H,1-2H2.
What are the key properties of 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine?
6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine has a molecular weight of 276.13 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-(5-fluoropyrimidin-4-yl)-2,3-dihydro-1,4-thiazine is sourced from PubChem (CID 178113169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).