About 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine
6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine (PubChem CID 178113224) has the molecular formula C12H10BrN3S2
and a molecular weight of 340.27 g/mol. Its IUPAC name is 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine.
Molecular Properties
| Compound Name | 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine |
| PubChem CID | 178113224 |
| Molecular Formula | C12H10BrN3S2 |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 338.95 |
| IUPAC Name | 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine |
| SMILES | BrC1=CN(c2cc(-c3ccsc3)ncn2)CCS1 |
| InChI | InChI=1S/C12H10BrN3S2/c13-11-6-16(2-4-18-11)12-5-10(14-8-15-12)9-1-3-17-7-9/h1,3,5-8H,2,4H2 |
| InChIKey | CUVYSIZWXFZSIF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine?
The IUPAC name of 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine (CID 178113224) is 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine.
What is the SMILES notation for 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine?
The canonical SMILES for 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine is BrC1=CN(c2cc(-c3ccsc3)ncn2)CCS1.
What is the InChIKey of 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine?
The InChIKey is CUVYSIZWXFZSIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrN3S2/c13-11-6-16(2-4-18-11)12-5-10(14-8-15-12)9-1-3-17-7-9/h1,3,5-8H,2,4H2.
What are the key properties of 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine?
6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine has a molecular weight of 340.27 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4-(6-thiophen-3-ylpyrimidin-4-yl)-2,3-dihydro-1,4-thiazine is sourced from PubChem (CID 178113224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).