C23H31N3O3S — CID 178113302
N-tert-butyl-4-methyl-2-[4-(2-oxo-2-piperazin-1-ylethyl)phenyl]benzenesulfonamide (PubChem CID 178113302) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is N-tert-butyl-4-methyl-2-[4-(2-oxo-2-piperazin-1-ylethyl)phenyl]benzenesulfonamide.
| Compound Name | N-tert-butyl-4-methyl-2-[4-(2-oxo-2-piperazin-1-ylethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 178113302 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-tert-butyl-4-methyl-2-[4-(2-oxo-2-piperazin-1-ylethyl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)(C)C)c(-c2ccc(CC(=O)N3CCNCC3)cc2)c1 |
| InChI | InChI=1S/C23H31N3O3S/c1-17-5-10-21(30(28,29)25-23(2,3)4)20(15-17)19-8-6-18(7-9-19)16-22(27)26-13-11-24-12-14-26/h5-10,15,24-25H,11-14,16H2,1-4H3 |
| InChIKey | VPUYXCVCXWAIRY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |