About (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane
(4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane (PubChem CID 178114086) has the molecular formula C16H28O4
and a molecular weight of 284.40 g/mol. Its IUPAC name is (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane.
Molecular Properties
| Compound Name | (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane |
| PubChem CID | 178114086 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane |
| SMILES | C=C(CC(CC/C(C)=C1\OCOC1=C)OC)OC.CC |
| InChI | InChI=1S/C14H22O4.C2H6/c1-10(14-12(3)17-9-18-14)6-7-13(16-5)8-11(2)15-4;1-2/h13H,2-3,6-9H2,1,4-5H3;1-2H3/b14-10-; |
| InChIKey | XENNZCMETZYRHW-DZOOLQPHSA-N |
| XLogP | 4.15 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane?
The IUPAC name of (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane (CID 178114086) is (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane.
What is the SMILES notation for (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane?
The canonical SMILES for (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane is C=C(CC(CC/C(C)=C1\OCOC1=C)OC)OC.CC.
What is the InChIKey of (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane?
The InChIKey is XENNZCMETZYRHW-DZOOLQPHSA-N. The full InChI is InChI=1S/C14H22O4.C2H6/c1-10(14-12(3)17-9-18-14)6-7-13(16-5)8-11(2)15-4;1-2/h13H,2-3,6-9H2,1,4-5H3;1-2H3/b14-10-;.
What are the key properties of (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane?
(4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane has a molecular weight of 284.40 g/mol, XLogP of 4.15, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-(5,7-dimethoxyoct-7-en-2-ylidene)-5-methylidene-1,3-dioxolane;ethane is sourced from PubChem (CID 178114086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).